C20H20ClNO3S — CID 139257261
3-[(E)-5-chloropent-1-enyl]-2-(4-methylphenyl)sulfonyl-3H-isoindol-1-one (PubChem CID 139257261) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is 3-[(E)-5-chloropent-1-enyl]-2-(4-methylphenyl)sulfonyl-3H-isoindol-1-one.
| Compound Name | 3-[(E)-5-chloropent-1-enyl]-2-(4-methylphenyl)sulfonyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 139257261 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-[(E)-5-chloropent-1-enyl]-2-(4-methylphenyl)sulfonyl-3H-isoindol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3ccccc3C2/C=C/CCCCl)cc1 |
| InChI | InChI=1S/C20H20ClNO3S/c1-15-10-12-16(13-11-15)26(24,25)22-19(9-3-2-6-14-21)17-7-4-5-8-18(17)20(22)23/h3-5,7-13,19H,2,6,14H2,1H3/b9-3+ |
| InChIKey | CMZYOEHJGPEEMM-YCRREMRBSA-N |
| XLogP | 4.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|