C14H14N2 — CID 139257283
(E)-N,N,N',N'-tetrakis(prop-2-ynyl)ethene-1,2-diamine (PubChem CID 139257283) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetrakis(prop-2-ynyl)ethene-1,2-diamine.
| Compound Name | (E)-N,N,N',N'-tetrakis(prop-2-ynyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 139257283 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (E)-N,N,N',N'-tetrakis(prop-2-ynyl)ethene-1,2-diamine |
| SMILES | C#CCN(/C=C/N(CC#C)CC#C)CC#C |
| InChI | InChI=1S/C14H14N2/c1-5-9-15(10-6-2)13-14-16(11-7-3)12-8-4/h1-4,13-14H,9-12H2/b14-13+ |
| InChIKey | AXXZWMYORALFMG-BUHFOSPRSA-N |
| XLogP | 0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|