About 5-amino-1,2-dihydrotetrazole-5-carboxylic acid
5-amino-1,2-dihydrotetrazole-5-carboxylic acid (PubChem CID 139257961) has the molecular formula C2H5N5O2
and a molecular weight of 131.09 g/mol. Its IUPAC name is 5-amino-1,2-dihydrotetrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-1,2-dihydrotetrazole-5-carboxylic acid |
| PubChem CID | 139257961 |
| Molecular Formula | C2H5N5O2 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 5-amino-1,2-dihydrotetrazole-5-carboxylic acid |
| SMILES | NC1(C(=O)O)N=NNN1 |
| InChI | InChI=1S/C2H5N5O2/c3-2(1(8)9)4-6-7-5-2/h3H2,(H,4,7)(H,5,6)(H,8,9) |
| InChIKey | PMMCMVQGJMPRKV-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-1,2-dihydrotetrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,2-dihydrotetrazole-5-carboxylic acid?
The IUPAC name of 5-amino-1,2-dihydrotetrazole-5-carboxylic acid (CID 139257961) is 5-amino-1,2-dihydrotetrazole-5-carboxylic acid.
What is the SMILES notation for 5-amino-1,2-dihydrotetrazole-5-carboxylic acid?
The canonical SMILES for 5-amino-1,2-dihydrotetrazole-5-carboxylic acid is NC1(C(=O)O)N=NNN1.
What is the InChIKey of 5-amino-1,2-dihydrotetrazole-5-carboxylic acid?
The InChIKey is PMMCMVQGJMPRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5O2/c3-2(1(8)9)4-6-7-5-2/h3H2,(H,4,7)(H,5,6)(H,8,9).
What are the key properties of 5-amino-1,2-dihydrotetrazole-5-carboxylic acid?
5-amino-1,2-dihydrotetrazole-5-carboxylic acid has a molecular weight of 131.09 g/mol, XLogP of -1.84, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,2-dihydrotetrazole-5-carboxylic acid is sourced from PubChem (CID 139257961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).