C14H19ClO4 — CID 139258141
(1S,2R,3S,4R)-3-[(Z)-3-chloro-1-ethoxy-1-oxobut-2-en-2-yl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 139258141) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[(Z)-3-chloro-1-ethoxy-1-oxobut-2-en-2-yl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4R)-3-[(Z)-3-chloro-1-ethoxy-1-oxobut-2-en-2-yl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 139258141 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1S,2R,3S,4R)-3-[(Z)-3-chloro-1-ethoxy-1-oxobut-2-en-2-yl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)/C(=C(/C)Cl)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)O |
| InChI | InChI=1S/C14H19ClO4/c1-3-19-14(18)10(7(2)15)11-8-4-5-9(6-8)12(11)13(16)17/h8-9,11-12H,3-6H2,1-2H3,(H,16,17)/b10-7-/t8-,9+,11-,12-/m1/s1 |
| InChIKey | NHVRLUYPVYLPIP-HSXZDVKASA-N |
| XLogP | 2.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|