C28H41F3O7 — CID 139258185
[(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139258185) has the molecular formula C28H41F3O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139258185 |
| Molecular Formula | C28H41F3O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCC/C(C)=C/[C@@H](OC(=O)C(OC)(c1ccccc1)C(F)(F)F)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C28H41F3O7/c1-8-9-10-12-15-20(2)18-22(23-19-36-25(3,33-5)26(4,34-6)38-23)37-24(32)27(35-7,28(29,30)31)21-16-13-11-14-17-21/h11,13-14,16-18,22-23H,8-10,12,15,19H2,1-7H3/b20-18+/t22-,23+,25-,26-,27?/m1/s1 |
| InChIKey | XSDFCWHMWCTGPP-QURPILIESA-N |
| XLogP | 6.06 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|