About sodium;tributylazanium;sulfate
sodium;tributylazanium;sulfate (PubChem CID 139258248) has the molecular formula C12H28NNaO4S
and a molecular weight of 305.42 g/mol. Its IUPAC name is sodium;tributylazanium;sulfate.
Molecular Properties
| Compound Name | sodium;tributylazanium;sulfate |
| PubChem CID | 139258248 |
| Molecular Formula | C12H28NNaO4S |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | sodium;tributylazanium;sulfate |
| SMILES | CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])[O-].[Na+] |
| InChI | InChI=1S/C12H27N.Na.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;;1-5(2,3)4/h4-12H2,1-3H3;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | IEOCVVABJOGPQI-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;tributylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;tributylazanium;sulfate?
The IUPAC name of sodium;tributylazanium;sulfate (CID 139258248) is sodium;tributylazanium;sulfate.
What is the SMILES notation for sodium;tributylazanium;sulfate?
The canonical SMILES for sodium;tributylazanium;sulfate is CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])[O-].[Na+].
What is the InChIKey of sodium;tributylazanium;sulfate?
The InChIKey is IEOCVVABJOGPQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27N.Na.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;;1-5(2,3)4/h4-12H2,1-3H3;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;tributylazanium;sulfate?
sodium;tributylazanium;sulfate has a molecular weight of 305.42 g/mol, XLogP of -2.06, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;tributylazanium;sulfate is sourced from PubChem (CID 139258248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).