C48H30Br3N3 — CID 139258315
4,9,14-tris(4-bromophenyl)-3,8,13-triphenyl-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 139258315) has the molecular formula C48H30Br3N3 and a molecular weight of 888.50 g/mol. Its IUPAC name is 4,9,14-tris(4-bromophenyl)-3,8,13-triphenyl-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 4,9,14-tris(4-bromophenyl)-3,8,13-triphenyl-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 139258315 |
| Molecular Formula | C48H30Br3N3 |
| Molecular Weight | 888.50 g/mol |
| Exact Mass | 885.00 |
| IUPAC Name | 4,9,14-tris(4-bromophenyl)-3,8,13-triphenyl-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | Brc1ccc(-c2cc3c(c4cc(-c5ccc(Br)cc5)n(-c5ccccc5)c4c4cc(-c5ccc(Br)cc5)n(-c5ccccc5)c34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H30Br3N3/c49-34-22-16-31(17-23-34)43-28-40-46(52(43)37-10-4-1-5-11-37)41-29-44(32-18-24-35(50)25-19-32)53(38-12-6-2-7-13-38)48(41)42-30-45(33-20-26-36(51)27-21-33)54(47(40)42)39-14-8-3-9-15-39/h1-30H |
| InChIKey | QTIFIHVNZFOTCK-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.50 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |