C24H15ClFNO4 — CID 139259500
(3S)-3-[(3S)-3-(4-chlorophenyl)-2-oxo-1-benzofuran-3-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 139259500) has the molecular formula C24H15ClFNO4 and a molecular weight of 435.84 g/mol. Its IUPAC name is (3S)-3-[(3S)-3-(4-chlorophenyl)-2-oxo-1-benzofuran-3-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(3S)-3-(4-chlorophenyl)-2-oxo-1-benzofuran-3-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259500 |
| Molecular Formula | C24H15ClFNO4 |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (3S)-3-[(3S)-3-(4-chlorophenyl)-2-oxo-1-benzofuran-3-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([C@@]2(c3ccc(Cl)cc3)C(=O)Oc3ccccc32)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H15ClFNO4/c25-15-7-5-14(6-8-15)24(18-3-1-2-4-20(18)31-23(24)30)19-13-21(28)27(22(19)29)17-11-9-16(26)10-12-17/h1-12,19H,13H2/t19-,24+/m1/s1 |
| InChIKey | KLPNWWOSABSMJP-DVECYGJZSA-N |
| XLogP | 4.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|