C21H41N3 — CID 139259814
1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]guanidine (PubChem CID 139259814) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]guanidine.
| Compound Name | 1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]guanidine |
|---|---|
| PubChem CID | 139259814 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]guanidine |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1/N=C(\N)N[C@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H41N3/c1-13(2)17-9-7-15(5)11-19(17)23-21(22)24-20-12-16(6)8-10-18(20)14(3)4/h13-20H,7-12H2,1-6H3,(H3,22,23,24)/t15-,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | UNDOIQHDVUIDOH-MUJBESKKSA-N |
| XLogP | 4.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|