About ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate
ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate (PubChem CID 139260047) has the molecular formula C23H21NO4
and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate.
Molecular Properties
| Compound Name | ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
| PubChem CID | 139260047 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)OCC)[C@H]1CC(=O)N(C(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H21NO4/c1-3-18(23(27)28-4-2)19-15-20(25)24(22(19)26)21(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,19,21H,1,4,15H2,2H3/t19-/m1/s1 |
| InChIKey | QLXZDVHMROFVBS-LJQANCHMSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate?
The IUPAC name of ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate (CID 139260047) is ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate.
What is the SMILES notation for ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate?
The canonical SMILES for ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate is C=C=C(C(=O)OCC)[C@H]1CC(=O)N(C(c2ccccc2)c2ccccc2)C1=O.
What is the InChIKey of ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate?
The InChIKey is QLXZDVHMROFVBS-LJQANCHMSA-N. The full InChI is InChI=1S/C23H21NO4/c1-3-18(23(27)28-4-2)19-15-20(25)24(22(19)26)21(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,19,21H,1,4,15H2,2H3/t19-/m1/s1.
What are the key properties of ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate?
ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate has a molecular weight of 375.42 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3R)-1-benzhydryl-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate is sourced from PubChem (CID 139260047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).