About hepta-1,2-dien-6-yn-4-ol
hepta-1,2-dien-6-yn-4-ol (PubChem CID 139260508) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is hepta-1,2-dien-6-yn-4-ol.
Molecular Properties
| Compound Name | hepta-1,2-dien-6-yn-4-ol |
| PubChem CID | 139260508 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | hepta-1,2-dien-6-yn-4-ol |
| SMILES | C#CCC(O)C=C=C |
| InChI | InChI=1S/C7H8O/c1-3-5-7(8)6-4-2/h1,6-8H,2,5H2 |
| InChIKey | SQQPQLIVSTUEOV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,2-dien-6-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,2-dien-6-yn-4-ol?
The IUPAC name of hepta-1,2-dien-6-yn-4-ol (CID 139260508) is hepta-1,2-dien-6-yn-4-ol.
What is the SMILES notation for hepta-1,2-dien-6-yn-4-ol?
The canonical SMILES for hepta-1,2-dien-6-yn-4-ol is C#CCC(O)C=C=C.
What is the InChIKey of hepta-1,2-dien-6-yn-4-ol?
The InChIKey is SQQPQLIVSTUEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O/c1-3-5-7(8)6-4-2/h1,6-8H,2,5H2.
What are the key properties of hepta-1,2-dien-6-yn-4-ol?
hepta-1,2-dien-6-yn-4-ol has a molecular weight of 108.14 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,2-dien-6-yn-4-ol is sourced from PubChem (CID 139260508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).