C13H11FO — CID 139260551
4-(3-fluorophenyl)hepta-1,2-dien-6-yn-4-ol (PubChem CID 139260551) has the molecular formula C13H11FO and a molecular weight of 202.23 g/mol. Its IUPAC name is 4-(3-fluorophenyl)hepta-1,2-dien-6-yn-4-ol.
| Compound Name | 4-(3-fluorophenyl)hepta-1,2-dien-6-yn-4-ol |
|---|---|
| PubChem CID | 139260551 |
| Molecular Formula | C13H11FO |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-(3-fluorophenyl)hepta-1,2-dien-6-yn-4-ol |
| SMILES | C#CCC(O)(C=C=C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H11FO/c1-3-8-13(15,9-4-2)11-6-5-7-12(14)10-11/h1,5-7,9-10,15H,2,8H2 |
| InChIKey | IPPDIEKHUJOKGW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|