About 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol
4-(2-bromophenyl)hepta-1,2,6-trien-4-ol (PubChem CID 139260587) has the molecular formula C13H13BrO
and a molecular weight of 265.15 g/mol. Its IUPAC name is 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol.
Molecular Properties
| Compound Name | 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol |
| PubChem CID | 139260587 |
| Molecular Formula | C13H13BrO |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol |
| SMILES | C=C=CC(O)(CC=C)c1ccccc1Br |
| InChI | InChI=1S/C13H13BrO/c1-3-9-13(15,10-4-2)11-7-5-6-8-12(11)14/h3,5-8,10,15H,1-2,9H2 |
| InChIKey | BMYSRKNOOSVMIK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol?
The IUPAC name of 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol (CID 139260587) is 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol.
What is the SMILES notation for 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol?
The canonical SMILES for 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol is C=C=CC(O)(CC=C)c1ccccc1Br.
What is the InChIKey of 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol?
The InChIKey is BMYSRKNOOSVMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO/c1-3-9-13(15,10-4-2)11-7-5-6-8-12(11)14/h3,5-8,10,15H,1-2,9H2.
What are the key properties of 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol?
4-(2-bromophenyl)hepta-1,2,6-trien-4-ol has a molecular weight of 265.15 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenyl)hepta-1,2,6-trien-4-ol is sourced from PubChem (CID 139260587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).