C29H37BrN2OS4 — CID 139260701
5-[5-(5-bromo-3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde (PubChem CID 139260701) has the molecular formula C29H37BrN2OS4 and a molecular weight of 637.80 g/mol. Its IUPAC name is 5-[5-(5-bromo-3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde.
| Compound Name | 5-[5-(5-bromo-3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260701 |
| Molecular Formula | C29H37BrN2OS4 |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | 5-[5-(5-bromo-3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
| SMILES | CCCCCCCCc1cc(Br)sc1-c1nc2sc(-c3sc(C=O)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C29H37BrN2OS4/c1-3-5-7-9-11-13-15-20-17-22(19-33)34-24(20)26-31-28-29(36-26)32-27(37-28)25-21(18-23(30)35-25)16-14-12-10-8-6-4-2/h17-19H,3-16H2,1-2H3 |
| InChIKey | AJNYJGOKJVCAFJ-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|