C21H32O5 — CID 139260757
[(4S)-4-methoxy-4-[(6S)-6-prop-2-enyl-1,4-dioxaspiro[4.5]decan-6-yl]but-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 139260757) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [(4S)-4-methoxy-4-[(6S)-6-prop-2-enyl-1,4-dioxaspiro[4.5]decan-6-yl]but-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(4S)-4-methoxy-4-[(6S)-6-prop-2-enyl-1,4-dioxaspiro[4.5]decan-6-yl]but-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139260757 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(4S)-4-methoxy-4-[(6S)-6-prop-2-enyl-1,4-dioxaspiro[4.5]decan-6-yl]but-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@]1([C@H](C#CCOC(=O)C(C)(C)C)OC)CCCCC12OCCO2 |
| InChI | InChI=1S/C21H32O5/c1-6-11-20(12-7-8-13-21(20)25-15-16-26-21)17(23-5)10-9-14-24-18(22)19(2,3)4/h6,17H,1,7-8,11-16H2,2-5H3/t17-,20+/m0/s1 |
| InChIKey | RCBVJKTYFLBPSA-FXAWDEMLSA-N |
| XLogP | 3.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|