C22H22Cl3NO5S — CID 139261185
N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide (PubChem CID 139261185) has the molecular formula C22H22Cl3NO5S and a molecular weight of 518.85 g/mol. Its IUPAC name is N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 139261185 |
| Molecular Formula | C22H22Cl3NO5S |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H](O)[C@H]2NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H22Cl3NO5S/c1-12-7-9-14(10-8-12)32-20-16(26-21(28)22(23,24)25)17(27)18-15(30-20)11-29-19(31-18)13-5-3-2-4-6-13/h2-10,15-20,27H,11H2,1H3,(H,26,28)/t15-,16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | ZHIZMHJASXHXPP-PJBUMPDVSA-N |
| XLogP | 4.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|