C12H10N2S2 — CID 139261276
2-[3-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-1,3-thiazole (PubChem CID 139261276) has the molecular formula C12H10N2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-[3-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-1,3-thiazole.
| Compound Name | 2-[3-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 139261276 |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-[3-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-1,3-thiazole |
| SMILES | c1cc(C2=NCCS2)cc(-c2nccs2)c1 |
| InChI | InChI=1S/C12H10N2S2/c1-2-9(11-13-4-6-15-11)8-10(3-1)12-14-5-7-16-12/h1-4,6,8H,5,7H2 |
| InChIKey | CGBDLHZXFCQKNR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |