C41H46N2O4 — CID 139261489
(4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethyl-3,3-dimethylbenzo[g]indol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 139261489) has the molecular formula C41H46N2O4 and a molecular weight of 630.83 g/mol. Its IUPAC name is (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethyl-3,3-dimethylbenzo[g]indol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethyl-3,3-dimethylbenzo[g]indol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261489 |
| Molecular Formula | C41H46N2O4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethyl-3,3-dimethylbenzo[g]indol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCCCN1/C(=C/C2=C([O-])/C(=C\C3=[N+](CC)c4c(ccc5ccccc45)C3(C)C)C2=O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C41H46N2O4/c1-7-9-10-11-12-15-22-43-33-21-19-27(39(46)47)23-32(33)41(5,6)35(43)25-30-37(44)29(38(30)45)24-34-40(3,4)31-20-18-26-16-13-14-17-28(26)36(31)42(34)8-2/h13-14,16-21,23-25H,7-12,15,22H2,1-6H3,(H-,44,45,46,47) |
| InChIKey | KQFYDFCTSTWRDH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|