C35H37F3N2O4 — CID 139261497
(4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[[3,3-dimethyl-1-(4,4,4-trifluorobutyl)indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate (PubChem CID 139261497) has the molecular formula C35H37F3N2O4 and a molecular weight of 606.69 g/mol. Its IUPAC name is (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[[3,3-dimethyl-1-(4,4,4-trifluorobutyl)indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[[3,3-dimethyl-1-(4,4,4-trifluorobutyl)indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261497 |
| Molecular Formula | C35H37F3N2O4 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[[3,3-dimethyl-1-(4,4,4-trifluorobutyl)indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCN1/C(=C/C2=C([O-])/C(=C\C3=[N+](CCCC(F)(F)F)c4ccccc4C3(C)C)C2=O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C35H37F3N2O4/c1-6-7-16-39-27-14-13-21(32(43)44)18-25(27)34(4,5)29(39)20-23-30(41)22(31(23)42)19-28-33(2,3)24-11-8-9-12-26(24)40(28)17-10-15-35(36,37)38/h8-9,11-14,18-20H,6-7,10,15-17H2,1-5H3,(H-,41,42,43,44) |
| InChIKey | NHFGMOZULJLBMK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|