C34H36N2O4 — CID 139261503
(4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 139261503) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261503 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (4E)-2-[(E)-(1-butyl-5-carboxy-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCN1/C(=C/C2=C([O-])/C(=C\c3cc[n+](CCCC)c4ccccc34)C2=O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C34H36N2O4/c1-5-7-16-35-18-15-22(24-11-9-10-12-28(24)35)19-25-31(37)26(32(25)38)21-30-34(3,4)27-20-23(33(39)40)13-14-29(27)36(30)17-8-6-2/h9-15,18-21H,5-8,16-17H2,1-4H3,(H-,37,38,39,40) |
| InChIKey | DVEXQZSBCURUEE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|