C43H55IN2O4 — CID 139261525
(4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(5-iodo-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 139261525) has the molecular formula C43H55IN2O4 and a molecular weight of 790.83 g/mol. Its IUPAC name is (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(5-iodo-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(5-iodo-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261525 |
| Molecular Formula | C43H55IN2O4 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.32 |
| IUPAC Name | (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(5-iodo-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCCCN1/C(=C/C2=C([O-])/C(=C/C3=[N+](CCCCCCCC)c4ccc(C(=O)O)cc4C3(C)C)C2=O)C(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C43H55IN2O4/c1-7-9-11-13-15-17-23-45-35-21-19-29(41(49)50)25-33(35)42(3,4)37(45)27-31-39(47)32(40(31)48)28-38-43(5,6)34-26-30(44)20-22-36(34)46(38)24-18-16-14-12-10-8-2/h19-22,25-28H,7-18,23-24H2,1-6H3,(H-,47,48,49,50) |
| InChIKey | ULXKCYIJISREIT-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|