C41H47N3O4 — CID 139261549
(4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,1,7-trimethylpyrrolo[3,2-f]quinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 139261549) has the molecular formula C41H47N3O4 and a molecular weight of 645.84 g/mol. Its IUPAC name is (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,1,7-trimethylpyrrolo[3,2-f]quinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,1,7-trimethylpyrrolo[3,2-f]quinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261549 |
| Molecular Formula | C41H47N3O4 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | (4Z)-4-[(5-carboxy-3,3-dimethyl-1-octylindol-1-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,1,7-trimethylpyrrolo[3,2-f]quinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCCC[N+]1=C(/C=C2\C(=O)C(/C=C3/N(CC)c4ccc5nc(C)ccc5c4C3(C)C)=C2[O-])C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C41H47N3O4/c1-8-10-11-12-13-14-21-44-32-19-16-26(39(47)48)22-30(32)40(4,5)34(44)23-28-37(45)29(38(28)46)24-35-41(6,7)36-27-17-15-25(3)42-31(27)18-20-33(36)43(35)9-2/h15-20,22-24H,8-14,21H2,1-7H3,(H-,45,46,47,48) |
| InChIKey | GMTOVSRZHCXGLP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|