C36H40N2O4 — CID 139261551
(4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethylquinolin-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 139261551) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethylquinolin-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethylquinolin-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 139261551 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | (4E)-2-[(E)-(5-carboxy-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(1-ethylquinolin-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCCCN1/C(=C/C2=C([O-])/C(=C\c3ccc4ccccc4[n+]3CC)C2=O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C36H40N2O4/c1-5-7-8-9-10-13-20-38-31-19-17-25(35(41)42)21-29(31)36(3,4)32(38)23-28-33(39)27(34(28)40)22-26-18-16-24-14-11-12-15-30(24)37(26)6-2/h11-12,14-19,21-23H,5-10,13,20H2,1-4H3,(H-,39,40,41,42) |
| InChIKey | FRWLDJXDNFNXQU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|