C16H25N5O5 — CID 139261908
tert-butyl (2S)-4-azido-2-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 139261908) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is tert-butyl (2S)-4-azido-2-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-azido-2-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139261908 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl (2S)-4-azido-2-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CC(N=[N+]=[N-])CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N5O5/c1-16(2,3)26-15(24)21-9-10(18-19-17)8-12(21)13(22)20-7-5-6-11(20)14(23)25-4/h10-12H,5-9H2,1-4H3/t10?,11-,12-/m0/s1 |
| InChIKey | ZBZAPELSNZUGJS-RAMGSTBQSA-N |
| XLogP | 1.84 |
| TPSA | 124.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|