C20H45N5O2Zn+2 — CID 139261928
zinc;(2S)-2-amino-1-(1,4,7,10-tetrazacyclododec-1-yl)dodecan-1-one;hydrate (PubChem CID 139261928) has the molecular formula C20H45N5O2Zn+2 and a molecular weight of 453.00 g/mol. Its IUPAC name is zinc;(2S)-2-amino-1-(1,4,7,10-tetrazacyclododec-1-yl)dodecan-1-one;hydrate.
| Compound Name | zinc;(2S)-2-amino-1-(1,4,7,10-tetrazacyclododec-1-yl)dodecan-1-one;hydrate |
|---|---|
| PubChem CID | 139261928 |
| Molecular Formula | C20H45N5O2Zn+2 |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | zinc;(2S)-2-amino-1-(1,4,7,10-tetrazacyclododec-1-yl)dodecan-1-one;hydrate |
| SMILES | CCCCCCCCCC[C@H](N)C(=O)N1CCNCCNCCNCC1.O.[Zn+2] |
| InChI | InChI=1S/C20H43N5O.H2O.Zn/c1-2-3-4-5-6-7-8-9-10-19(21)20(26)25-17-15-23-13-11-22-12-14-24-16-18-25;;/h19,22-24H,2-18,21H2,1H3;1H2;/q;;+2/t19-;;/m0../s1 |
| InChIKey | HCNKMOSKXYGPBA-TXEPZDRESA-N |
| XLogP | 0.63 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|