C72H50N6O4Zn — CID 139261959
zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis[4-(N-phenylanilino)phenyl]porphyrin-21,23-diid-5-yl]benzoate (PubChem CID 139261959) has the molecular formula C72H50N6O4Zn and a molecular weight of 1128.62 g/mol. Its IUPAC name is zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis[4-(N-phenylanilino)phenyl]porphyrin-21,23-diid-5-yl]benzoate.
| Compound Name | zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis[4-(N-phenylanilino)phenyl]porphyrin-21,23-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 139261959 |
| Molecular Formula | C72H50N6O4Zn |
| Molecular Weight | 1128.62 g/mol |
| Exact Mass | 1126.32 |
| IUPAC Name | zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis[4-(N-phenylanilino)phenyl]porphyrin-21,23-diid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OC)cc4)c4ccc([n-]4)c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4nc(c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C72H51N6O4.Zn/c1-81-71(79)51-27-23-47(24-28-51)67-59-39-40-60(73-59)68(48-25-29-52(30-26-48)72(80)82-2)62-42-44-64(75-62)70(50-33-37-58(38-34-50)78(55-19-11-5-12-20-55)56-21-13-6-14-22-56)66-46-45-65(76-66)69(63-43-41-61(67)74-63)49-31-35-57(36-32-49)77(53-15-7-3-8-16-53)54-17-9-4-10-18-54;/h3-46H,1-2H3,(H-,73,74,75,76,79,80);/q-1;+2/p-1/b67-59-,67-61-,68-60-,68-62-,69-63-,69-65-,70-64-,70-66-; |
| InChIKey | STKQOLRCYZZSCL-ZMYOUSDQSA-M |
| XLogP | 17.09 |
| TPSA | 113.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.62 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|