C9H17BO2 — CID 139262017
2-(1,1-dideuterioprop-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139262017) has the molecular formula C9H17BO2 and a molecular weight of 170.06 g/mol. Its IUPAC name is 2-(1,1-dideuterioprop-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,1-dideuterioprop-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139262017 |
| Molecular Formula | C9H17BO2 |
| Molecular Weight | 170.06 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-(1,1-dideuterioprop-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]C([2H])(C=C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C9H17BO2/c1-6-7-10-11-8(2,3)9(4,5)12-10/h6H,1,7H2,2-5H3/i7D2 |
| InChIKey | YMHIEPNFCBNQQU-RJSZUWSASA-N |
| XLogP | 2.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|