C18H24O5 — CID 139262205
dimethyl 6-acetyl-5-methyl-8-methylidene-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate (PubChem CID 139262205) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is dimethyl 6-acetyl-5-methyl-8-methylidene-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-acetyl-5-methyl-8-methylidene-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139262205 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | dimethyl 6-acetyl-5-methyl-8-methylidene-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate |
| SMILES | C=C1CC(C(C)=O)=C(C)CC2CC(C(=O)OC)(C(=O)OC)CC12 |
| InChI | InChI=1S/C18H24O5/c1-10-6-13-8-18(16(20)22-4,17(21)23-5)9-15(13)11(2)7-14(10)12(3)19/h13,15H,2,6-9H2,1,3-5H3 |
| InChIKey | IPMFIGFCFGNSID-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|