C19H21FN2O4S — CID 139262474
butyl (E)-3-[5-fluoro-2-[methyl(pyridin-2-ylsulfonyl)amino]phenyl]prop-2-enoate (PubChem CID 139262474) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is butyl (E)-3-[5-fluoro-2-[methyl(pyridin-2-ylsulfonyl)amino]phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[5-fluoro-2-[methyl(pyridin-2-ylsulfonyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139262474 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | butyl (E)-3-[5-fluoro-2-[methyl(pyridin-2-ylsulfonyl)amino]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cc(F)ccc1N(C)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-3-4-13-26-19(23)11-8-15-14-16(20)9-10-17(15)22(2)27(24,25)18-7-5-6-12-21-18/h5-12,14H,3-4,13H2,1-2H3/b11-8+ |
| InChIKey | CCRFUBHLXSMXNI-DHZHZOJOSA-N |
| XLogP | 3.40 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|