About [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone
[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone (PubChem CID 139262529) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone |
| PubChem CID | 139262529 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone |
| SMILES | CO/N=C1\CCCc2cccc(C(=O)c3ccccc3)c21 |
| InChI | InChI=1S/C18H17NO2/c1-21-19-16-12-6-10-13-9-5-11-15(17(13)16)18(20)14-7-3-2-4-8-14/h2-5,7-9,11H,6,10,12H2,1H3/b19-16+ |
| InChIKey | KELRIELOHYWXTL-KNTRCKAVSA-N |
| XLogP | 3.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone?
The IUPAC name of [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone (CID 139262529) is [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone.
What is the SMILES notation for [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone?
The canonical SMILES for [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone is CO/N=C1\CCCc2cccc(C(=O)c3ccccc3)c21.
What is the InChIKey of [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone?
The InChIKey is KELRIELOHYWXTL-KNTRCKAVSA-N. The full InChI is InChI=1S/C18H17NO2/c1-21-19-16-12-6-10-13-9-5-11-15(17(13)16)18(20)14-7-3-2-4-8-14/h2-5,7-9,11H,6,10,12H2,1H3/b19-16+.
What are the key properties of [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone?
[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone has a molecular weight of 279.34 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]-phenylmethanone is sourced from PubChem (CID 139262529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).