About (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one
(3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one (PubChem CID 139262654) has the molecular formula C18H15F3O4
and a molecular weight of 352.31 g/mol. Its IUPAC name is (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one.
Molecular Properties
| Compound Name | (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one |
| PubChem CID | 139262654 |
| Molecular Formula | C18H15F3O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one |
| SMILES | O=C1OCCO[C@]1(c1ccccc1)[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3O4/c19-18(20,21)14-8-6-12(7-9-14)15(22)17(13-4-2-1-3-5-13)16(23)24-10-11-25-17/h1-9,15,22H,10-11H2/t15-,17-/m1/s1 |
| InChIKey | DMGMXWCKYMQEKH-NVXWUHKLSA-N |
| XLogP | 3.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one?
The IUPAC name of (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one (CID 139262654) is (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one.
What is the SMILES notation for (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one?
The canonical SMILES for (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one is O=C1OCCO[C@]1(c1ccccc1)[C@H](O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one?
The InChIKey is DMGMXWCKYMQEKH-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H15F3O4/c19-18(20,21)14-8-6-12(7-9-14)15(22)17(13-4-2-1-3-5-13)16(23)24-10-11-25-17/h1-9,15,22H,10-11H2/t15-,17-/m1/s1.
What are the key properties of (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one?
(3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one has a molecular weight of 352.31 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(R)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]-3-phenyl-1,4-dioxan-2-one is sourced from PubChem (CID 139262654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).