C11H15NO2 — CID 139262688
ethyl (E)-3-(4-aminocyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 139262688) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl (E)-3-(4-aminocyclohexa-2,4-dien-1-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-aminocyclohexa-2,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 139262688 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl (E)-3-(4-aminocyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1C=CC(N)=CC1 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3,5-9H,2,4,12H2,1H3/b8-5+ |
| InChIKey | RRXYESPINUXPAZ-VMPITWQZSA-N |
| XLogP | 1.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|