About 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine
10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine (PubChem CID 139262741) has the molecular formula C40H53NS3
and a molecular weight of 644.07 g/mol. Its IUPAC name is 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine.
Molecular Properties
| Compound Name | 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine |
| PubChem CID | 139262741 |
| Molecular Formula | C40H53NS3 |
| Molecular Weight | 644.07 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine |
| SMILES | CCCCCCc1csc(-c2ccc3c(c2)Sc2cc(-c4cc(CCCCCC)cs4)ccc2N3CC(CC)CCCC)c1 |
| InChI | InChI=1S/C40H53NS3/c1-5-9-12-14-17-31-23-37(42-28-31)33-19-21-35-39(25-33)44-40-26-34(38-24-32(29-43-38)18-15-13-10-6-2)20-22-36(40)41(35)27-30(8-4)16-11-7-3/h19-26,28-30H,5-18,27H2,1-4H3 |
| InChIKey | ZLOFANSTQYAWEV-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.07 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine?
The IUPAC name of 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine (CID 139262741) is 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine.
What is the SMILES notation for 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine?
The canonical SMILES for 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine is CCCCCCc1csc(-c2ccc3c(c2)Sc2cc(-c4cc(CCCCCC)cs4)ccc2N3CC(CC)CCCC)c1.
What is the InChIKey of 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine?
The InChIKey is ZLOFANSTQYAWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H53NS3/c1-5-9-12-14-17-31-23-37(42-28-31)33-19-21-35-39(25-33)44-40-26-34(38-24-32(29-43-38)18-15-13-10-6-2)20-22-36(40)41(35)27-30(8-4)16-11-7-3/h19-26,28-30H,5-18,27H2,1-4H3.
What are the key properties of 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine?
10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine has a molecular weight of 644.07 g/mol, XLogP of 14.21, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-ethylhexyl)-3,7-bis(4-hexylthiophen-2-yl)phenothiazine is sourced from PubChem (CID 139262741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).