C17H30O5Si — CID 139262758
(1R,2S,6R,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5,12-trioxatricyclo[7.2.1.02,6]dodec-10-en-1-ol (PubChem CID 139262758) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (1R,2S,6R,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5,12-trioxatricyclo[7.2.1.02,6]dodec-10-en-1-ol.
| Compound Name | (1R,2S,6R,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5,12-trioxatricyclo[7.2.1.02,6]dodec-10-en-1-ol |
|---|---|
| PubChem CID | 139262758 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (1R,2S,6R,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3,5,12-trioxatricyclo[7.2.1.02,6]dodec-10-en-1-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3C=C[C@@](O)(O3)[C@H]2O1 |
| InChI | InChI=1S/C17H30O5Si/c1-15(2,3)23(6,7)22-12-10-11-8-9-17(18,19-11)14-13(12)20-16(4,5)21-14/h8-9,11-14,18H,10H2,1-7H3/t11-,12-,13-,14-,17+/m0/s1 |
| InChIKey | PMWAXACEWNLFRB-GGOFEBJYSA-N |
| XLogP | 2.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|