C16H27N — CID 139262780
(4R,5S,7R)-4-[(2S)-but-3-en-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decane (PubChem CID 139262780) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (4R,5S,7R)-4-[(2S)-but-3-en-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decane.
| Compound Name | (4R,5S,7R)-4-[(2S)-but-3-en-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 139262780 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (4R,5S,7R)-4-[(2S)-but-3-en-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decane |
| SMILES | C=CC[C@H]1CCC[C@]2(CCC[C@@H]2[C@@H](C)C=C)N1 |
| InChI | InChI=1S/C16H27N/c1-4-8-14-9-6-11-16(17-14)12-7-10-15(16)13(3)5-2/h4-5,13-15,17H,1-2,6-12H2,3H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | XWOTXAPWMKWATA-CAOSSQGBSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|