About (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride
(2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride (PubChem CID 139263445) has the molecular formula C10H12BrClF3N
and a molecular weight of 318.56 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride |
| PubChem CID | 139263445 |
| Molecular Formula | C10H12BrClF3N |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride |
| SMILES | CC[C@@](N)(c1ccc(Br)cc1)C(F)(F)F.Cl |
| InChI | InChI=1S/C10H11BrF3N.ClH/c1-2-9(15,10(12,13)14)7-3-5-8(11)6-4-7;/h3-6H,2,15H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | IFHGQIQFZOFAJD-SBSPUUFOSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride?
The IUPAC name of (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride (CID 139263445) is (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride.
What is the SMILES notation for (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride?
The canonical SMILES for (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride is CC[C@@](N)(c1ccc(Br)cc1)C(F)(F)F.Cl.
What is the InChIKey of (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride?
The InChIKey is IFHGQIQFZOFAJD-SBSPUUFOSA-N. The full InChI is InChI=1S/C10H11BrF3N.ClH/c1-2-9(15,10(12,13)14)7-3-5-8(11)6-4-7;/h3-6H,2,15H2,1H3;1H/t9-;/m1./s1.
What are the key properties of (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride?
(2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride has a molecular weight of 318.56 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-bromophenyl)-1,1,1-trifluorobutan-2-amine;hydrochloride is sourced from PubChem (CID 139263445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).