C33H58O2Si — CID 139263509
(3S,8R,9S,10R,13S,15R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-15-ol (PubChem CID 139263509) has the molecular formula C33H58O2Si and a molecular weight of 514.91 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,15R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-15-ol.
| Compound Name | (3S,8R,9S,10R,13S,15R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-15-ol |
|---|---|
| PubChem CID | 139263509 |
| Molecular Formula | C33H58O2Si |
| Molecular Weight | 514.91 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | (3S,8R,9S,10R,13S,15R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-15-ol |
| SMILES | CC(C)CCC[C@@H](C)C1=CC(O)C2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H58O2Si/c1-22(2)12-11-13-23(3)28-21-29(34)30-26-15-14-24-20-25(35-36(9,10)31(4,5)6)16-18-32(24,7)27(26)17-19-33(28,30)8/h14,21-23,25-27,29-30,34H,11-13,15-20H2,1-10H3/t23-,25+,26-,27+,29?,30?,32+,33-/m1/s1 |
| InChIKey | MOWBPKVREYEADI-IDPBXWCXSA-N |
| XLogP | 9.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.91 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|