C29H32O6 — CID 139263610
[(3aR,4R,5R,6aS)-4-[(Z,1S)-1-benzoyloxyoct-2-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 139263610) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(Z,1S)-1-benzoyloxyoct-2-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(Z,1S)-1-benzoyloxyoct-2-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 139263610 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(Z,1S)-1-benzoyloxyoct-2-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CCCCC/C=C\[C@H](OC(=O)c1ccccc1)[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H32O6/c1-2-3-4-5-12-17-23(34-28(31)20-13-8-6-9-14-20)27-22-18-26(30)33-24(22)19-25(27)35-29(32)21-15-10-7-11-16-21/h6-17,22-25,27H,2-5,18-19H2,1H3/b17-12-/t22-,23-,24-,25+,27-/m0/s1 |
| InChIKey | TXXFEKWXJGTBHU-HKZOWXCSSA-N |
| XLogP | 5.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|