C25H50O — CID 139263692
(2S,6S,10S,14S)-2,6,10,14-tetramethylhenicosanal (PubChem CID 139263692) has the molecular formula C25H50O and a molecular weight of 366.67 g/mol. Its IUPAC name is (2S,6S,10S,14S)-2,6,10,14-tetramethylhenicosanal.
| Compound Name | (2S,6S,10S,14S)-2,6,10,14-tetramethylhenicosanal |
|---|---|
| PubChem CID | 139263692 |
| Molecular Formula | C25H50O |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.39 |
| IUPAC Name | (2S,6S,10S,14S)-2,6,10,14-tetramethylhenicosanal |
| SMILES | CCCCCCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C=O |
| InChI | InChI=1S/C25H50O/c1-6-7-8-9-10-14-22(2)15-11-16-23(3)17-12-18-24(4)19-13-20-25(5)21-26/h21-25H,6-20H2,1-5H3/t22-,23-,24-,25?/m0/s1 |
| InChIKey | VOBRGQBJWGBITA-UKXRBIRESA-N |
| XLogP | 8.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|