C15H31NO4S — CID 139263699
[(2E,5R)-5,9-dimethyldeca-2,8-dienyl] sulfate;trimethylazanium (PubChem CID 139263699) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is [(2E,5R)-5,9-dimethyldeca-2,8-dienyl] sulfate;trimethylazanium.
| Compound Name | [(2E,5R)-5,9-dimethyldeca-2,8-dienyl] sulfate;trimethylazanium |
|---|---|
| PubChem CID | 139263699 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | [(2E,5R)-5,9-dimethyldeca-2,8-dienyl] sulfate;trimethylazanium |
| SMILES | CC(C)=CCC[C@@H](C)C/C=C/COS(=O)(=O)[O-].C[NH+](C)C |
| InChI | InChI=1S/C12H22O4S.C3H9N/c1-11(2)7-6-9-12(3)8-4-5-10-16-17(13,14)15;1-4(2)3/h4-5,7,12H,6,8-10H2,1-3H3,(H,13,14,15);1-3H3/b5-4+;/t12-;/m0./s1 |
| InChIKey | NZRUTIUBJZXSDB-ZSHNDGMBSA-N |
| XLogP | 1.55 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|