About methyl (4Z,6E)-3-methylundeca-4,6-dienoate
methyl (4Z,6E)-3-methylundeca-4,6-dienoate (PubChem CID 139263830) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is methyl (4Z,6E)-3-methylundeca-4,6-dienoate.
Molecular Properties
| Compound Name | methyl (4Z,6E)-3-methylundeca-4,6-dienoate |
| PubChem CID | 139263830 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | methyl (4Z,6E)-3-methylundeca-4,6-dienoate |
| SMILES | CCCC/C=C/C=C\C(C)CC(=O)OC |
| InChI | InChI=1S/C13H22O2/c1-4-5-6-7-8-9-10-12(2)11-13(14)15-3/h7-10,12H,4-6,11H2,1-3H3/b8-7+,10-9- |
| InChIKey | BIUOUWUBCABBCN-GOJKSUSPSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4Z,6E)-3-methylundeca-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4Z,6E)-3-methylundeca-4,6-dienoate?
The IUPAC name of methyl (4Z,6E)-3-methylundeca-4,6-dienoate (CID 139263830) is methyl (4Z,6E)-3-methylundeca-4,6-dienoate.
What is the SMILES notation for methyl (4Z,6E)-3-methylundeca-4,6-dienoate?
The canonical SMILES for methyl (4Z,6E)-3-methylundeca-4,6-dienoate is CCCC/C=C/C=C\C(C)CC(=O)OC.
What is the InChIKey of methyl (4Z,6E)-3-methylundeca-4,6-dienoate?
The InChIKey is BIUOUWUBCABBCN-GOJKSUSPSA-N. The full InChI is InChI=1S/C13H22O2/c1-4-5-6-7-8-9-10-12(2)11-13(14)15-3/h7-10,12H,4-6,11H2,1-3H3/b8-7+,10-9-.
What are the key properties of methyl (4Z,6E)-3-methylundeca-4,6-dienoate?
methyl (4Z,6E)-3-methylundeca-4,6-dienoate has a molecular weight of 210.32 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4Z,6E)-3-methylundeca-4,6-dienoate is sourced from PubChem (CID 139263830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).