C18H30O2Si — CID 139263849
methyl (2Z,4E)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-trimethylsilylpenta-2,4-dienoate (PubChem CID 139263849) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is methyl (2Z,4E)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-trimethylsilylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-trimethylsilylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 139263849 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | methyl (2Z,4E)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-trimethylsilylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(/C=C/C1=C(C)CCCC1(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-14-9-8-12-18(2,3)16(14)11-10-15(21(5,6)7)13-17(19)20-4/h10-11,13H,8-9,12H2,1-7H3/b11-10+,15-13- |
| InChIKey | RUXCQALWVYYTKO-JXIMYUQQSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|