C14H22O — CID 139263903
spiro[2,4,4a,5,6,7-hexahydrochromene-3,1'-cyclohexane] (PubChem CID 139263903) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is spiro[2,4,4a,5,6,7-hexahydrochromene-3,1'-cyclohexane].
| Compound Name | spiro[2,4,4a,5,6,7-hexahydrochromene-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 139263903 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | spiro[2,4,4a,5,6,7-hexahydrochromene-3,1'-cyclohexane] |
| SMILES | C1=C2OCC3(CCCCC3)CC2CCC1 |
| InChI | InChI=1S/C14H22O/c1-4-8-14(9-5-1)10-12-6-2-3-7-13(12)15-11-14/h7,12H,1-6,8-11H2 |
| InChIKey | SDKHUCDMZWQXMM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |