C10F18 — CID 139264064
1,2,3,3,4,4-hexakis(trifluoromethyl)cyclobutene (PubChem CID 139264064) has the molecular formula C10F18 and a molecular weight of 462.07 g/mol. Its IUPAC name is 1,2,3,3,4,4-hexakis(trifluoromethyl)cyclobutene.
| Compound Name | 1,2,3,3,4,4-hexakis(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 139264064 |
| Molecular Formula | C10F18 |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 1,2,3,3,4,4-hexakis(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10F18/c11-5(12,13)1-2(6(14,15)16)4(9(23,24)25,10(26,27)28)3(1,7(17,18)19)8(20,21)22 |
| InChIKey | FTCMQNZDAKSQPP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|