C11H9F9 — CID 139264091
7,7,8,8,9,9,10,10,10-nonafluoro-2-methyldec-2-en-5-yne (PubChem CID 139264091) has the molecular formula C11H9F9 and a molecular weight of 312.18 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,10-nonafluoro-2-methyldec-2-en-5-yne.
| Compound Name | 7,7,8,8,9,9,10,10,10-nonafluoro-2-methyldec-2-en-5-yne |
|---|---|
| PubChem CID | 139264091 |
| Molecular Formula | C11H9F9 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 7,7,8,8,9,9,10,10,10-nonafluoro-2-methyldec-2-en-5-yne |
| SMILES | CC(C)=CCC#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F9/c1-7(2)5-3-4-6-8(12,13)9(14,15)10(16,17)11(18,19)20/h5H,3H2,1-2H3 |
| InChIKey | PPMKBQCYNQYOID-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|