C10H13F8O3P — CID 139264097
(E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene (PubChem CID 139264097) has the molecular formula C10H13F8O3P and a molecular weight of 364.17 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 139264097 |
| Molecular Formula | C10H13F8O3P |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C(=C(\C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F8O3P/c1-4-20-22(19,21-5-2)10(17,18)7(9(14,15)16)6(3)8(11,12)13/h4-5H2,1-3H3/b7-6+ |
| InChIKey | GGAATVLBAMTPLK-VOTSOKGWSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|