C7H5F7 — CID 139264104
5,5,6,6,7,7,7-heptafluorohepta-2,3-diene (PubChem CID 139264104) has the molecular formula C7H5F7 and a molecular weight of 222.10 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluorohepta-2,3-diene.
| Compound Name | 5,5,6,6,7,7,7-heptafluorohepta-2,3-diene |
|---|---|
| PubChem CID | 139264104 |
| Molecular Formula | C7H5F7 |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluorohepta-2,3-diene |
| SMILES | CC=C=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7/c1-2-3-4-5(8,9)6(10,11)7(12,13)14/h2,4H,1H3 |
| InChIKey | YAITZUWKSHGKED-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|