C11H7F13 — CID 139264106
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldeca-2,3-diene (PubChem CID 139264106) has the molecular formula C11H7F13 and a molecular weight of 386.15 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldeca-2,3-diene.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldeca-2,3-diene |
|---|---|
| PubChem CID | 139264106 |
| Molecular Formula | C11H7F13 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-methyldeca-2,3-diene |
| SMILES | CC(C)=C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F13/c1-5(2)3-4-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h4H,1-2H3 |
| InChIKey | KXWLJCCLPWOXCY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|