About (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene
(Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene (PubChem CID 139264136) has the molecular formula C9H17F2O3P
and a molecular weight of 242.20 g/mol. Its IUPAC name is (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene.
Molecular Properties
| Compound Name | (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene |
| PubChem CID | 139264136 |
| Molecular Formula | C9H17F2O3P |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene |
| SMILES | C/C=C\CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C9H17F2O3P/c1-4-7-8-9(10,11)15(12,13-5-2)14-6-3/h4,7H,5-6,8H2,1-3H3/b7-4- |
| InChIKey | YAHGJBMJCCAIDV-DAXSKMNVSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene?
The IUPAC name of (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene (CID 139264136) is (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene.
What is the SMILES notation for (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene?
The canonical SMILES for (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene is C/C=C\CC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene?
The InChIKey is YAHGJBMJCCAIDV-DAXSKMNVSA-N. The full InChI is InChI=1S/C9H17F2O3P/c1-4-7-8-9(10,11)15(12,13-5-2)14-6-3/h4,7H,5-6,8H2,1-3H3/b7-4-.
What are the key properties of (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene?
(Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene has a molecular weight of 242.20 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-diethoxyphosphoryl-5,5-difluoropent-2-ene is sourced from PubChem (CID 139264136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).