C19H34N2O2Se — CID 139264824
methyl (3S,4S)-2,2,5,5-tetramethyl-4-[(2,6,6-trimethyl-2,5-dihydro-1H-pyridin-5-yl)selanylmethyl]pyrrolidine-3-carboxylate (PubChem CID 139264824) has the molecular formula C19H34N2O2Se and a molecular weight of 401.45 g/mol. Its IUPAC name is methyl (3S,4S)-2,2,5,5-tetramethyl-4-[(2,6,6-trimethyl-2,5-dihydro-1H-pyridin-5-yl)selanylmethyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4S)-2,2,5,5-tetramethyl-4-[(2,6,6-trimethyl-2,5-dihydro-1H-pyridin-5-yl)selanylmethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139264824 |
| Molecular Formula | C19H34N2O2Se |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | methyl (3S,4S)-2,2,5,5-tetramethyl-4-[(2,6,6-trimethyl-2,5-dihydro-1H-pyridin-5-yl)selanylmethyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C[Se]C2C=CC(C)NC2(C)C)C(C)(C)NC1(C)C |
| InChI | InChI=1S/C19H34N2O2Se/c1-12-9-10-14(18(4,5)20-12)24-11-13-15(16(22)23-8)19(6,7)21-17(13,2)3/h9-10,12-15,20-21H,11H2,1-8H3/t12?,13-,14?,15+/m0/s1 |
| InChIKey | QXYRHMGTWDIWLT-OOJKYFRXSA-N |
| XLogP | 2.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|